C10H14N2O4S — CID 88751080
(5R)-2-acetamido-3-ethyl-7-oxo-4-thia-1-azabicyclo[3.2.0]heptane-3-carboxylic acid (PubChem CID 88751080) has the molecular formula C10H14N2O4S and a molecular weight of 258.30 g/mol. Its IUPAC name is (5R)-2-acetamido-3-ethyl-7-oxo-4-thia-1-azabicyclo[3.2.0]heptane-3-carboxylic acid.
| Compound Name | (5R)-2-acetamido-3-ethyl-7-oxo-4-thia-1-azabicyclo[3.2.0]heptane-3-carboxylic acid |
|---|---|
| PubChem CID | 88751080 |
| Molecular Formula | C10H14N2O4S |
| Molecular Weight | 258.30 g/mol |
| Exact Mass | 258.07 |
| IUPAC Name | (5R)-2-acetamido-3-ethyl-7-oxo-4-thia-1-azabicyclo[3.2.0]heptane-3-carboxylic acid |
| SMILES | CCC1(C(=O)O)S[C@@H]2CC(=O)N2C1NC(C)=O |
| InChI | InChI=1S/C10H14N2O4S/c1-3-10(9(15)16)8(11-5(2)13)12-6(14)4-7(12)17-10/h7-8H,3-4H2,1-2H3,(H,11,13)(H,15,16)/t7-,8?,10?/m1/s1 |
| InChIKey | VYEOOSQJSFSUED-ZNFPMYQNSA-N |
| XLogP | -0.01 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.30 |
| LogP ≤ 5 | -0.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |