C16H11Cl4N3O2S2 — CID 88753012
1-[5-chloro-2-[[4-nitro-2-(trichloromethyl)phenyl]disulfanyl]phenyl]-4,5-dihydroimidazole (PubChem CID 88753012) has the molecular formula C16H11Cl4N3O2S2 and a molecular weight of 483.23 g/mol. Its IUPAC name is 1-[5-chloro-2-[[4-nitro-2-(trichloromethyl)phenyl]disulfanyl]phenyl]-4,5-dihydroimidazole.
| Compound Name | 1-[5-chloro-2-[[4-nitro-2-(trichloromethyl)phenyl]disulfanyl]phenyl]-4,5-dihydroimidazole |
|---|---|
| PubChem CID | 88753012 |
| Molecular Formula | C16H11Cl4N3O2S2 |
| Molecular Weight | 483.23 g/mol |
| Exact Mass | 480.90 |
| IUPAC Name | 1-[5-chloro-2-[[4-nitro-2-(trichloromethyl)phenyl]disulfanyl]phenyl]-4,5-dihydroimidazole |
| SMILES | O=[N+]([O-])c1ccc(SSc2ccc(Cl)cc2N2C=NCC2)c(C(Cl)(Cl)Cl)c1 |
| InChI | InChI=1S/C16H11Cl4N3O2S2/c17-10-1-3-15(13(7-10)22-6-5-21-9-22)27-26-14-4-2-11(23(24)25)8-12(14)16(18,19)20/h1-4,7-9H,5-6H2 |
| InChIKey | JHCBGBAEWBVKFM-UHFFFAOYSA-N |
| XLogP | 6.72 |
| TPSA | 58.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.23 |
| LogP ≤ 5 | 6.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|