C11H11N3O2 — CID 88755109
5-[4-(oxiran-2-ylmethoxy)phenyl]-1H-1,2,4-triazole (PubChem CID 88755109) has the molecular formula C11H11N3O2 and a molecular weight of 217.23 g/mol. Its IUPAC name is 5-[4-(oxiran-2-ylmethoxy)phenyl]-1H-1,2,4-triazole.
| Compound Name | 5-[4-(oxiran-2-ylmethoxy)phenyl]-1H-1,2,4-triazole |
|---|---|
| PubChem CID | 88755109 |
| Molecular Formula | C11H11N3O2 |
| Molecular Weight | 217.23 g/mol |
| Exact Mass | 217.09 |
| IUPAC Name | 5-[4-(oxiran-2-ylmethoxy)phenyl]-1H-1,2,4-triazole |
| SMILES | c1n[nH]c(-c2ccc(OCC3CO3)cc2)n1 |
| InChI | InChI=1S/C11H11N3O2/c1-3-9(15-5-10-6-16-10)4-2-8(1)11-12-7-13-14-11/h1-4,7,10H,5-6H2,(H,12,13,14) |
| InChIKey | XSJMEASPCILDJJ-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 63.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.23 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|