C21H15Br6O4P — CID 88755851
(2-propan-2-ylphenyl) bis(2,3,4-tribromophenyl) phosphate (PubChem CID 88755851) has the molecular formula C21H15Br6O4P and a molecular weight of 841.74 g/mol. Its IUPAC name is (2-propan-2-ylphenyl) bis(2,3,4-tribromophenyl) phosphate.
| Compound Name | (2-propan-2-ylphenyl) bis(2,3,4-tribromophenyl) phosphate |
|---|---|
| PubChem CID | 88755851 |
| Molecular Formula | C21H15Br6O4P |
| Molecular Weight | 841.74 g/mol |
| Exact Mass | 835.58 |
| IUPAC Name | (2-propan-2-ylphenyl) bis(2,3,4-tribromophenyl) phosphate |
| SMILES | CC(C)c1ccccc1OP(=O)(Oc1ccc(Br)c(Br)c1Br)Oc1ccc(Br)c(Br)c1Br |
| InChI | InChI=1S/C21H15Br6O4P/c1-11(2)12-5-3-4-6-15(12)29-32(28,30-16-9-7-13(22)18(24)20(16)26)31-17-10-8-14(23)19(25)21(17)27/h3-11H,1-2H3 |
| InChIKey | FFGDFDRCEKVSSQ-UHFFFAOYSA-N |
| XLogP | 11.03 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 841.74 |
| LogP ≤ 5 | 11.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|