C18H31N3 — CID 88755990
4-[[(4-cyano-2,2-diethylbutylidene)amino]methyl]-4-ethylhexanenitrile (PubChem CID 88755990) has the molecular formula C18H31N3 and a molecular weight of 289.47 g/mol. Its IUPAC name is 4-[[(4-cyano-2,2-diethylbutylidene)amino]methyl]-4-ethylhexanenitrile.
| Compound Name | 4-[[(4-cyano-2,2-diethylbutylidene)amino]methyl]-4-ethylhexanenitrile |
|---|---|
| PubChem CID | 88755990 |
| Molecular Formula | C18H31N3 |
| Molecular Weight | 289.47 g/mol |
| Exact Mass | 289.25 |
| IUPAC Name | 4-[[(4-cyano-2,2-diethylbutylidene)amino]methyl]-4-ethylhexanenitrile |
| SMILES | CCC(/C=N/CC(CC)(CC)CCC#N)(CC)CCC#N |
| InChI | InChI=1S/C18H31N3/c1-5-17(6-2,11-9-13-19)15-21-16-18(7-3,8-4)12-10-14-20/h15H,5-12,16H2,1-4H3/b21-15+ |
| InChIKey | PIQXVEUDCFOKJE-RCCKNPSSSA-N |
| XLogP | 5.28 |
| TPSA | 59.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.47 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|