C10H19N3O3 — CID 161144236
dimethylcarbamic acid;5-hydroxyimino-4,4-dimethylpentanenitrile (PubChem CID 161144236) has the molecular formula C10H19N3O3 and a molecular weight of 229.28 g/mol. Its IUPAC name is dimethylcarbamic acid;5-hydroxyimino-4,4-dimethylpentanenitrile.
| Compound Name | dimethylcarbamic acid;5-hydroxyimino-4,4-dimethylpentanenitrile |
|---|---|
| PubChem CID | 161144236 |
| Molecular Formula | C10H19N3O3 |
| Molecular Weight | 229.28 g/mol |
| Exact Mass | 229.14 |
| IUPAC Name | dimethylcarbamic acid;5-hydroxyimino-4,4-dimethylpentanenitrile |
| SMILES | CC(C)(C=NO)CCC#N.CN(C)C(=O)O |
| InChI | InChI=1S/C7H12N2O.C3H7NO2/c1-7(2,6-9-10)4-3-5-8;1-4(2)3(5)6/h6,10H,3-4H2,1-2H3;1-2H3,(H,5,6) |
| InChIKey | UNVMTOKQHSZAOZ-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 96.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.28 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|