C13H20N4O2 — CID 13163890
2,2-bis(2-cyanoethyl)-N,N'-diethylpropanediamide (PubChem CID 13163890) has the molecular formula C13H20N4O2 and a molecular weight of 264.33 g/mol. Its IUPAC name is 2,2-bis(2-cyanoethyl)-N,N'-diethylpropanediamide.
| Compound Name | 2,2-bis(2-cyanoethyl)-N,N'-diethylpropanediamide |
|---|---|
| PubChem CID | 13163890 |
| Molecular Formula | C13H20N4O2 |
| Molecular Weight | 264.33 g/mol |
| Exact Mass | 264.16 |
| IUPAC Name | 2,2-bis(2-cyanoethyl)-N,N'-diethylpropanediamide |
| SMILES | CCNC(=O)C(CCC#N)(CCC#N)C(=O)NCC |
| InChI | InChI=1S/C13H20N4O2/c1-3-16-11(18)13(7-5-9-14,8-6-10-15)12(19)17-4-2/h3-8H2,1-2H3,(H,16,18)(H,17,19) |
| InChIKey | XNUCGJAYOGFJBG-UHFFFAOYSA-N |
| XLogP | 0.85 |
| TPSA | 105.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.33 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|