C12H21N3O4 — CID 175005242
butanenitrile;2-(2-carboxypropan-2-yldiazenyl)-2-methylpropanoic acid (PubChem CID 175005242) has the molecular formula C12H21N3O4 and a molecular weight of 271.32 g/mol. Its IUPAC name is butanenitrile;2-(2-carboxypropan-2-yldiazenyl)-2-methylpropanoic acid.
| Compound Name | butanenitrile;2-(2-carboxypropan-2-yldiazenyl)-2-methylpropanoic acid |
|---|---|
| PubChem CID | 175005242 |
| Molecular Formula | C12H21N3O4 |
| Molecular Weight | 271.32 g/mol |
| Exact Mass | 271.15 |
| IUPAC Name | butanenitrile;2-(2-carboxypropan-2-yldiazenyl)-2-methylpropanoic acid |
| SMILES | CC(C)(/N=N/C(C)(C)C(=O)O)C(=O)O.CCCC#N |
| InChI | InChI=1S/C8H14N2O4.C4H7N/c1-7(2,5(11)12)9-10-8(3,4)6(13)14;1-2-3-4-5/h1-4H3,(H,11,12)(H,13,14);2-3H2,1H3/b10-9+; |
| InChIKey | LRNZYGBDTUGVTL-RRABGKBLSA-N |
| XLogP | 2.48 |
| TPSA | 123.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.32 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|