C12H19N3O4 — CID 86595156
2-(tert-butyldiazenyl)-2-(3-cyanopropyl)butanedioic acid (PubChem CID 86595156) has the molecular formula C12H19N3O4 and a molecular weight of 269.30 g/mol. Its IUPAC name is 2-(tert-butyldiazenyl)-2-(3-cyanopropyl)butanedioic acid.
| Compound Name | 2-(tert-butyldiazenyl)-2-(3-cyanopropyl)butanedioic acid |
|---|---|
| PubChem CID | 86595156 |
| Molecular Formula | C12H19N3O4 |
| Molecular Weight | 269.30 g/mol |
| Exact Mass | 269.14 |
| IUPAC Name | 2-(tert-butyldiazenyl)-2-(3-cyanopropyl)butanedioic acid |
| SMILES | CC(C)(C)/N=N/C(CCCC#N)(CC(=O)O)C(=O)O |
| InChI | InChI=1S/C12H19N3O4/c1-11(2,3)14-15-12(10(18)19,8-9(16)17)6-4-5-7-13/h4-6,8H2,1-3H3,(H,16,17)(H,18,19)/b15-14+ |
| InChIKey | DVNNAECXGVACPT-CCEZHUSRSA-N |
| XLogP | 2.23 |
| TPSA | 123.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.30 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|