C20H36N4O8 — CID 175812572
2-(2-carboxybutan-2-yldiazenyl)-2,3,3-trimethylbutanoic acid;2-(2-carboxypropan-2-yldiazenyl)-2-methylpropanoic acid (PubChem CID 175812572) has the molecular formula C20H36N4O8 and a molecular weight of 460.53 g/mol. Its IUPAC name is 2-(2-carboxybutan-2-yldiazenyl)-2,3,3-trimethylbutanoic acid;2-(2-carboxypropan-2-yldiazenyl)-2-methylpropanoic acid.
| Compound Name | 2-(2-carboxybutan-2-yldiazenyl)-2,3,3-trimethylbutanoic acid;2-(2-carboxypropan-2-yldiazenyl)-2-methylpropanoic acid |
|---|---|
| PubChem CID | 175812572 |
| Molecular Formula | C20H36N4O8 |
| Molecular Weight | 460.53 g/mol |
| Exact Mass | 460.25 |
| IUPAC Name | 2-(2-carboxybutan-2-yldiazenyl)-2,3,3-trimethylbutanoic acid;2-(2-carboxypropan-2-yldiazenyl)-2-methylpropanoic acid |
| SMILES | CC(C)(/N=N/C(C)(C)C(=O)O)C(=O)O.CCC(C)(/N=N/C(C)(C(=O)O)C(C)(C)C)C(=O)O |
| InChI | InChI=1S/C12H22N2O4.C8H14N2O4/c1-7-11(5,8(15)16)13-14-12(6,9(17)18)10(2,3)4;1-7(2,5(11)12)9-10-8(3,4)6(13)14/h7H2,1-6H3,(H,15,16)(H,17,18);1-4H3,(H,11,12)(H,13,14)/b14-13+;10-9+ |
| InChIKey | PVUKETJLWHMOOA-YJOMUKFESA-N |
| XLogP | 3.75 |
| TPSA | 198.64 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.53 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|