C12H18ClN3O3 — CID 173407109
[(5-cyano-3,3-dimethylpentylidene)amino] N-(2-chloroacetyl)-N-methylcarbamate (PubChem CID 173407109) has the molecular formula C12H18ClN3O3 and a molecular weight of 287.75 g/mol. Its IUPAC name is [(5-cyano-3,3-dimethylpentylidene)amino] N-(2-chloroacetyl)-N-methylcarbamate.
| Compound Name | [(5-cyano-3,3-dimethylpentylidene)amino] N-(2-chloroacetyl)-N-methylcarbamate |
|---|---|
| PubChem CID | 173407109 |
| Molecular Formula | C12H18ClN3O3 |
| Molecular Weight | 287.75 g/mol |
| Exact Mass | 287.10 |
| IUPAC Name | [(5-cyano-3,3-dimethylpentylidene)amino] N-(2-chloroacetyl)-N-methylcarbamate |
| SMILES | CN(C(=O)CCl)C(=O)ON=CCC(C)(C)CCC#N |
| InChI | InChI=1S/C12H18ClN3O3/c1-12(2,5-4-7-14)6-8-15-19-11(18)16(3)10(17)9-13/h8H,4-6,9H2,1-3H3 |
| InChIKey | YPUVTHFKQHITIQ-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 82.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.75 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|