C21H34N3O4S+ — CID 8875638
cyclopentyl-[2-(4-methoxy-3-piperidin-1-ylsulfonylanilino)-2-oxoethyl]-dimethylazanium (PubChem CID 8875638) has the molecular formula C21H34N3O4S+ and a molecular weight of 424.59 g/mol. Its IUPAC name is cyclopentyl-[2-(4-methoxy-3-piperidin-1-ylsulfonylanilino)-2-oxoethyl]-dimethylazanium.
| Compound Name | cyclopentyl-[2-(4-methoxy-3-piperidin-1-ylsulfonylanilino)-2-oxoethyl]-dimethylazanium |
|---|---|
| PubChem CID | 8875638 |
| Molecular Formula | C21H34N3O4S+ |
| Molecular Weight | 424.59 g/mol |
| Exact Mass | 424.23 |
| IUPAC Name | cyclopentyl-[2-(4-methoxy-3-piperidin-1-ylsulfonylanilino)-2-oxoethyl]-dimethylazanium |
| SMILES | COc1ccc(NC(=O)C[N+](C)(C)C2CCCC2)cc1S(=O)(=O)N1CCCCC1 |
| InChI | InChI=1S/C21H33N3O4S/c1-24(2,18-9-5-6-10-18)16-21(25)22-17-11-12-19(28-3)20(15-17)29(26,27)23-13-7-4-8-14-23/h11-12,15,18H,4-10,13-14,16H2,1-3H3/p+1 |
| InChIKey | FCWPAHUGKHONMN-UHFFFAOYSA-O |
| XLogP | 2.83 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.59 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|