C20H28N2 — CID 88761189
1-N-[(2-butylphenyl)methyl]-1-N'-(3-methylphenyl)ethane-1,1-diamine (PubChem CID 88761189) has the molecular formula C20H28N2 and a molecular weight of 296.46 g/mol. Its IUPAC name is 1-N-[(2-butylphenyl)methyl]-1-N'-(3-methylphenyl)ethane-1,1-diamine.
| Compound Name | 1-N-[(2-butylphenyl)methyl]-1-N'-(3-methylphenyl)ethane-1,1-diamine |
|---|---|
| PubChem CID | 88761189 |
| Molecular Formula | C20H28N2 |
| Molecular Weight | 296.46 g/mol |
| Exact Mass | 296.23 |
| IUPAC Name | 1-N-[(2-butylphenyl)methyl]-1-N'-(3-methylphenyl)ethane-1,1-diamine |
| SMILES | CCCCc1ccccc1CNC(C)Nc1cccc(C)c1 |
| InChI | InChI=1S/C20H28N2/c1-4-5-10-18-11-6-7-12-19(18)15-21-17(3)22-20-13-8-9-16(2)14-20/h6-9,11-14,17,21-22H,4-5,10,15H2,1-3H3 |
| InChIKey | LZYHRGSNNCZGDN-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.46 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|