C15H27Cl2N3O2 — CID 88762960
2-[2-[3-(diethylamino)-2-hydroxypropyl]phenyl]-N'-hydroxyethanimidamide;dihydrochloride (PubChem CID 88762960) has the molecular formula C15H27Cl2N3O2 and a molecular weight of 352.31 g/mol. Its IUPAC name is 2-[2-[3-(diethylamino)-2-hydroxypropyl]phenyl]-N'-hydroxyethanimidamide;dihydrochloride.
| Compound Name | 2-[2-[3-(diethylamino)-2-hydroxypropyl]phenyl]-N'-hydroxyethanimidamide;dihydrochloride |
|---|---|
| PubChem CID | 88762960 |
| Molecular Formula | C15H27Cl2N3O2 |
| Molecular Weight | 352.31 g/mol |
| Exact Mass | 351.15 |
| IUPAC Name | 2-[2-[3-(diethylamino)-2-hydroxypropyl]phenyl]-N'-hydroxyethanimidamide;dihydrochloride |
| SMILES | CCN(CC)CC(O)Cc1ccccc1CC(N)=NO.Cl.Cl |
| InChI | InChI=1S/C15H25N3O2.2ClH/c1-3-18(4-2)11-14(19)9-12-7-5-6-8-13(12)10-15(16)17-20;;/h5-8,14,19-20H,3-4,9-11H2,1-2H3,(H2,16,17);2*1H |
| InChIKey | ILHYCMUMZXXCHY-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 82.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.31 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|