C22H21N2O3+ — CID 8876386
(2R)-N-(1,3-benzodioxol-5-ylmethyl)-2-(3-phenylpyridin-1-ium-1-yl)propanamide (PubChem CID 8876386) has the molecular formula C22H21N2O3+ and a molecular weight of 361.42 g/mol. Its IUPAC name is (2R)-N-(1,3-benzodioxol-5-ylmethyl)-2-(3-phenylpyridin-1-ium-1-yl)propanamide.
| Compound Name | (2R)-N-(1,3-benzodioxol-5-ylmethyl)-2-(3-phenylpyridin-1-ium-1-yl)propanamide |
|---|---|
| PubChem CID | 8876386 |
| Molecular Formula | C22H21N2O3+ |
| Molecular Weight | 361.42 g/mol |
| Exact Mass | 361.15 |
| IUPAC Name | (2R)-N-(1,3-benzodioxol-5-ylmethyl)-2-(3-phenylpyridin-1-ium-1-yl)propanamide |
| SMILES | C[C@H](C(=O)NCc1ccc2c(c1)OCO2)[n+]1cccc(-c2ccccc2)c1 |
| InChI | InChI=1S/C22H20N2O3/c1-16(24-11-5-8-19(14-24)18-6-3-2-4-7-18)22(25)23-13-17-9-10-20-21(12-17)27-15-26-20/h2-12,14,16H,13,15H2,1H3/p+1/t16-/m1/s1 |
| InChIKey | LMSFAGCGORCVPX-MRXNPFEDSA-O |
| XLogP | 3.25 |
| TPSA | 51.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.42 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|