C21H27N2O3+ — CID 8877961
(2S)-N-(1,3-benzodioxol-5-ylmethyl)-2-(4-pentan-3-ylpyridin-1-ium-1-yl)propanamide (PubChem CID 8877961) has the molecular formula C21H27N2O3+ and a molecular weight of 355.46 g/mol. Its IUPAC name is (2S)-N-(1,3-benzodioxol-5-ylmethyl)-2-(4-pentan-3-ylpyridin-1-ium-1-yl)propanamide.
| Compound Name | (2S)-N-(1,3-benzodioxol-5-ylmethyl)-2-(4-pentan-3-ylpyridin-1-ium-1-yl)propanamide |
|---|---|
| PubChem CID | 8877961 |
| Molecular Formula | C21H27N2O3+ |
| Molecular Weight | 355.46 g/mol |
| Exact Mass | 355.20 |
| IUPAC Name | (2S)-N-(1,3-benzodioxol-5-ylmethyl)-2-(4-pentan-3-ylpyridin-1-ium-1-yl)propanamide |
| SMILES | CCC(CC)c1cc[n+]([C@@H](C)C(=O)NCc2ccc3c(c2)OCO3)cc1 |
| InChI | InChI=1S/C21H26N2O3/c1-4-17(5-2)18-8-10-23(11-9-18)15(3)21(24)22-13-16-6-7-19-20(12-16)26-14-25-19/h6-12,15,17H,4-5,13-14H2,1-3H3/p+1/t15-/m0/s1 |
| InChIKey | RXQPUALHBCCLEA-HNNXBMFYSA-O |
| XLogP | 3.48 |
| TPSA | 51.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.46 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|