C17H17N5O5S — CID 88763891
(6R)-7-[[(2Z)-2-(5-amino-2-pyridinyl)-2-methoxyiminoacetyl]amino]-3-ethenyl-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid (PubChem CID 88763891) has the molecular formula C17H17N5O5S and a molecular weight of 403.42 g/mol. Its IUPAC name is (6R)-7-[[(2Z)-2-(5-amino-2-pyridinyl)-2-methoxyiminoacetyl]amino]-3-ethenyl-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid.
| Compound Name | (6R)-7-[[(2Z)-2-(5-amino-2-pyridinyl)-2-methoxyiminoacetyl]amino]-3-ethenyl-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid |
|---|---|
| PubChem CID | 88763891 |
| Molecular Formula | C17H17N5O5S |
| Molecular Weight | 403.42 g/mol |
| Exact Mass | 403.10 |
| IUPAC Name | (6R)-7-[[(2Z)-2-(5-amino-2-pyridinyl)-2-methoxyiminoacetyl]amino]-3-ethenyl-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid |
| SMILES | C=CC1=C(C(=O)O)N2C(=O)C(NC(=O)/C(=N\OC)c3ccc(N)cn3)[C@H]2SC1 |
| InChI | InChI=1S/C17H17N5O5S/c1-3-8-7-28-16-12(15(24)22(16)13(8)17(25)26)20-14(23)11(21-27-2)10-5-4-9(18)6-19-10/h3-6,12,16H,1,7,18H2,2H3,(H,20,23)(H,25,26)/b21-11-/t12?,16-/m1/s1 |
| InChIKey | KDPQSXFWUVWWPJ-AOVPURRHSA-N |
| XLogP | -0.06 |
| TPSA | 147.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.42 |
| LogP ≤ 5 | -0.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|