C31H28N4O3SZn — CID 88765148
benzenesulfonic acid;2-pentylporphyrin;zinc (PubChem CID 88765148) has the molecular formula C31H28N4O3SZn and a molecular weight of 602.05 g/mol. Its IUPAC name is benzenesulfonic acid;2-pentylporphyrin;zinc.
| Compound Name | benzenesulfonic acid;2-pentylporphyrin;zinc |
|---|---|
| PubChem CID | 88765148 |
| Molecular Formula | C31H28N4O3SZn |
| Molecular Weight | 602.05 g/mol |
| Exact Mass | 600.12 |
| IUPAC Name | benzenesulfonic acid;2-pentylporphyrin;zinc |
| SMILES | CCCCCC1=CC2=N/C1=C\C1=N/C(=C\C3=N/C(=C\C4=N/C(=C\2)C=C4)C=C3)C=C1.O=S(=O)(O)c1ccccc1.[Zn] |
| InChI | InChI=1S/C25H22N4.C6H6O3S.Zn/c1-2-3-4-5-17-12-24-15-22-9-8-20(27-22)13-18-6-7-19(26-18)14-21-10-11-23(28-21)16-25(17)29-24;7-10(8,9)6-4-2-1-3-5-6;/h6-16H,2-5H2,1H3;1-5H,(H,7,8,9);/b18-13-,19-14-,20-13-,21-14-,22-15-,23-16-,24-15-,25-16-;; |
| InChIKey | IPZWAGQYCJNDOO-OKNCFHFJSA-N |
| XLogP | 6.46 |
| TPSA | 103.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 602.05 |
| LogP ≤ 5 | 6.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|