About (3-benzhydrylimidazol-4-yl) carbonochloridate;hydrochloride
(3-benzhydrylimidazol-4-yl) carbonochloridate;hydrochloride (PubChem CID 88765196) has the molecular formula C17H14Cl2N2O2
and a molecular weight of 349.22 g/mol. Its IUPAC name is (3-benzhydrylimidazol-4-yl) carbonochloridate;hydrochloride.
Molecular Properties
| Compound Name | (3-benzhydrylimidazol-4-yl) carbonochloridate;hydrochloride |
| PubChem CID | 88765196 |
| Molecular Formula | C17H14Cl2N2O2 |
| Molecular Weight | 349.22 g/mol |
| Exact Mass | 348.04 |
| IUPAC Name | (3-benzhydrylimidazol-4-yl) carbonochloridate;hydrochloride |
| SMILES | Cl.O=C(Cl)Oc1cncn1C(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C17H13ClN2O2.ClH/c18-17(21)22-15-11-19-12-20(15)16(13-7-3-1-4-8-13)14-9-5-2-6-10-14;/h1-12,16H;1H |
| InChIKey | QABAXEYXHGSUMF-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 44.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 349.22 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'} |
|---|
Analyze (3-benzhydrylimidazol-4-yl) carbonochloridate;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3-benzhydrylimidazol-4-yl) carbonochloridate;hydrochloride?
The IUPAC name of (3-benzhydrylimidazol-4-yl) carbonochloridate;hydrochloride (CID 88765196) is (3-benzhydrylimidazol-4-yl) carbonochloridate;hydrochloride.
What is the SMILES notation for (3-benzhydrylimidazol-4-yl) carbonochloridate;hydrochloride?
The canonical SMILES for (3-benzhydrylimidazol-4-yl) carbonochloridate;hydrochloride is Cl.O=C(Cl)Oc1cncn1C(c1ccccc1)c1ccccc1.
What is the InChIKey of (3-benzhydrylimidazol-4-yl) carbonochloridate;hydrochloride?
The InChIKey is QABAXEYXHGSUMF-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H13ClN2O2.ClH/c18-17(21)22-15-11-19-12-20(15)16(13-7-3-1-4-8-13)14-9-5-2-6-10-14;/h1-12,16H;1H.
What are the key properties of (3-benzhydrylimidazol-4-yl) carbonochloridate;hydrochloride?
(3-benzhydrylimidazol-4-yl) carbonochloridate;hydrochloride has a molecular weight of 349.22 g/mol, XLogP of 4.68, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (3-benzhydrylimidazol-4-yl) carbonochloridate;hydrochloride is sourced from PubChem (CID 88765196), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).