About 1-bromooctylcarbamic acid;hydrobromide
1-bromooctylcarbamic acid;hydrobromide (PubChem CID 88765955) has the molecular formula C9H19Br2NO2
and a molecular weight of 333.06 g/mol. Its IUPAC name is 1-bromooctylcarbamic acid;hydrobromide.
Molecular Properties
| Compound Name | 1-bromooctylcarbamic acid;hydrobromide |
| PubChem CID | 88765955 |
| Molecular Formula | C9H19Br2NO2 |
| Molecular Weight | 333.06 g/mol |
| Exact Mass | 330.98 |
| IUPAC Name | 1-bromooctylcarbamic acid;hydrobromide |
| SMILES | Br.CCCCCCCC(Br)NC(=O)O |
| InChI | InChI=1S/C9H18BrNO2.BrH/c1-2-3-4-5-6-7-8(10)11-9(12)13;/h8,11H,2-7H2,1H3,(H,12,13);1H |
| InChIKey | WVVINHUNKSRQQF-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 333.06 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|
Analyze 1-bromooctylcarbamic acid;hydrobromide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-bromooctylcarbamic acid;hydrobromide?
The IUPAC name of 1-bromooctylcarbamic acid;hydrobromide (CID 88765955) is 1-bromooctylcarbamic acid;hydrobromide.
What is the SMILES notation for 1-bromooctylcarbamic acid;hydrobromide?
The canonical SMILES for 1-bromooctylcarbamic acid;hydrobromide is Br.CCCCCCCC(Br)NC(=O)O.
What is the InChIKey of 1-bromooctylcarbamic acid;hydrobromide?
The InChIKey is WVVINHUNKSRQQF-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H18BrNO2.BrH/c1-2-3-4-5-6-7-8(10)11-9(12)13;/h8,11H,2-7H2,1H3,(H,12,13);1H.
What are the key properties of 1-bromooctylcarbamic acid;hydrobromide?
1-bromooctylcarbamic acid;hydrobromide has a molecular weight of 333.06 g/mol, XLogP of 3.91, 7 rotatable bonds, 2 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-bromooctylcarbamic acid;hydrobromide is sourced from PubChem (CID 88765955), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).