C25H26ClNO2S — CID 88775301
4-[[2-(6-chloro-7,8-dimethoxy-1,2,4,5-tetrahydro-3-benzazepin-3-yl)phenyl]methyl]cyclohexa-2,4-diene-1-thione (PubChem CID 88775301) has the molecular formula C25H26ClNO2S and a molecular weight of 440.01 g/mol. Its IUPAC name is 4-[[2-(6-chloro-7,8-dimethoxy-1,2,4,5-tetrahydro-3-benzazepin-3-yl)phenyl]methyl]cyclohexa-2,4-diene-1-thione.
| Compound Name | 4-[[2-(6-chloro-7,8-dimethoxy-1,2,4,5-tetrahydro-3-benzazepin-3-yl)phenyl]methyl]cyclohexa-2,4-diene-1-thione |
|---|---|
| PubChem CID | 88775301 |
| Molecular Formula | C25H26ClNO2S |
| Molecular Weight | 440.01 g/mol |
| Exact Mass | 439.14 |
| IUPAC Name | 4-[[2-(6-chloro-7,8-dimethoxy-1,2,4,5-tetrahydro-3-benzazepin-3-yl)phenyl]methyl]cyclohexa-2,4-diene-1-thione |
| SMILES | COc1cc2c(c(Cl)c1OC)CCN(c1ccccc1CC1=CCC(=S)C=C1)CC2 |
| InChI | InChI=1S/C25H26ClNO2S/c1-28-23-16-18-11-13-27(14-12-21(18)24(26)25(23)29-2)22-6-4-3-5-19(22)15-17-7-9-20(30)10-8-17/h3-9,16H,10-15H2,1-2H3 |
| InChIKey | MQZANQZWDJVLPW-UHFFFAOYSA-N |
| XLogP | 5.76 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.01 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thio_ketone(43)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|