About lithium;ethane;(4-ethenylphenyl)methylphosphonic acid
lithium;ethane;(4-ethenylphenyl)methylphosphonic acid (PubChem CID 88775368) has the molecular formula C11H16LiO3P
and a molecular weight of 234.16 g/mol. Its IUPAC name is lithium;ethane;(4-ethenylphenyl)methylphosphonic acid.
Molecular Properties
| Compound Name | lithium;ethane;(4-ethenylphenyl)methylphosphonic acid |
| PubChem CID | 88775368 |
| Molecular Formula | C11H16LiO3P |
| Molecular Weight | 234.16 g/mol |
| Exact Mass | 234.10 |
| IUPAC Name | lithium;ethane;(4-ethenylphenyl)methylphosphonic acid |
| SMILES | C=Cc1ccc(CP(=O)(O)O)cc1.[CH2-]C.[Li+] |
| InChI | InChI=1S/C9H11O3P.C2H5.Li/c1-2-8-3-5-9(6-4-8)7-13(10,11)12;1-2;/h2-6H,1,7H2,(H2,10,11,12);1H2,2H3;/q;-1;+1 |
| InChIKey | PRSGGUZZWPXHGL-UHFFFAOYSA-N |
| XLogP | -0.15 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 234.16 |
| LogP ≤ 5 | -0.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze lithium;ethane;(4-ethenylphenyl)methylphosphonic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of lithium;ethane;(4-ethenylphenyl)methylphosphonic acid?
The IUPAC name of lithium;ethane;(4-ethenylphenyl)methylphosphonic acid (CID 88775368) is lithium;ethane;(4-ethenylphenyl)methylphosphonic acid.
What is the SMILES notation for lithium;ethane;(4-ethenylphenyl)methylphosphonic acid?
The canonical SMILES for lithium;ethane;(4-ethenylphenyl)methylphosphonic acid is C=Cc1ccc(CP(=O)(O)O)cc1.[CH2-]C.[Li+].
What is the InChIKey of lithium;ethane;(4-ethenylphenyl)methylphosphonic acid?
The InChIKey is PRSGGUZZWPXHGL-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H11O3P.C2H5.Li/c1-2-8-3-5-9(6-4-8)7-13(10,11)12;1-2;/h2-6H,1,7H2,(H2,10,11,12);1H2,2H3;/q;-1;+1.
What are the key properties of lithium;ethane;(4-ethenylphenyl)methylphosphonic acid?
lithium;ethane;(4-ethenylphenyl)methylphosphonic acid has a molecular weight of 234.16 g/mol, XLogP of -0.15, 3 rotatable bonds, 2 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for lithium;ethane;(4-ethenylphenyl)methylphosphonic acid is sourced from PubChem (CID 88775368), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).