About 2,8-dihydroperoxy-2,8-dimethylnon-6-yn-4-ol
2,8-dihydroperoxy-2,8-dimethylnon-6-yn-4-ol (PubChem CID 88777125) has the molecular formula C11H20O5
and a molecular weight of 232.28 g/mol. Its IUPAC name is 2,8-dihydroperoxy-2,8-dimethylnon-6-yn-4-ol.
Molecular Properties
| Compound Name | 2,8-dihydroperoxy-2,8-dimethylnon-6-yn-4-ol |
| PubChem CID | 88777125 |
| Molecular Formula | C11H20O5 |
| Molecular Weight | 232.28 g/mol |
| Exact Mass | 232.13 |
| IUPAC Name | 2,8-dihydroperoxy-2,8-dimethylnon-6-yn-4-ol |
| SMILES | CC(C)(C#CCC(O)CC(C)(C)OO)OO |
| InChI | InChI=1S/C11H20O5/c1-10(2,15-13)7-5-6-9(12)8-11(3,4)16-14/h9,12-14H,6,8H2,1-4H3 |
| InChIKey | XQZBLKCJDDFLTM-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 79.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 232.28 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 2,8-dihydroperoxy-2,8-dimethylnon-6-yn-4-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,8-dihydroperoxy-2,8-dimethylnon-6-yn-4-ol?
The IUPAC name of 2,8-dihydroperoxy-2,8-dimethylnon-6-yn-4-ol (CID 88777125) is 2,8-dihydroperoxy-2,8-dimethylnon-6-yn-4-ol.
What is the SMILES notation for 2,8-dihydroperoxy-2,8-dimethylnon-6-yn-4-ol?
The canonical SMILES for 2,8-dihydroperoxy-2,8-dimethylnon-6-yn-4-ol is CC(C)(C#CCC(O)CC(C)(C)OO)OO.
What is the InChIKey of 2,8-dihydroperoxy-2,8-dimethylnon-6-yn-4-ol?
The InChIKey is XQZBLKCJDDFLTM-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H20O5/c1-10(2,15-13)7-5-6-9(12)8-11(3,4)16-14/h9,12-14H,6,8H2,1-4H3.
What are the key properties of 2,8-dihydroperoxy-2,8-dimethylnon-6-yn-4-ol?
2,8-dihydroperoxy-2,8-dimethylnon-6-yn-4-ol has a molecular weight of 232.28 g/mol, XLogP of 1.67, 5 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2,8-dihydroperoxy-2,8-dimethylnon-6-yn-4-ol is sourced from PubChem (CID 88777125), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).