C12H16O4 — CID 10176888
(Z)-2,9-dihydroperoxy-2,9-dimethyldec-5-en-3,7-diyne (PubChem CID 10176888) has the molecular formula C12H16O4 and a molecular weight of 224.26 g/mol. Its IUPAC name is (Z)-2,9-dihydroperoxy-2,9-dimethyldec-5-en-3,7-diyne.
| Compound Name | (Z)-2,9-dihydroperoxy-2,9-dimethyldec-5-en-3,7-diyne |
|---|---|
| PubChem CID | 10176888 |
| Molecular Formula | C12H16O4 |
| Molecular Weight | 224.26 g/mol |
| Exact Mass | 224.10 |
| IUPAC Name | (Z)-2,9-dihydroperoxy-2,9-dimethyldec-5-en-3,7-diyne |
| SMILES | CC(C)(C#C/C=C\C#CC(C)(C)OO)OO |
| InChI | InChI=1S/C12H16O4/c1-11(2,15-13)9-7-5-6-8-10-12(3,4)16-14/h5-6,13-14H,1-4H3/b6-5- |
| InChIKey | KWFDUBDCUMZXFK-WAYWQWQTSA-N |
| XLogP | 2.09 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.26 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|