About azane;6-(2-fluoropropan-2-yloxy)hexan-1-ol;sulfuric acid
azane;6-(2-fluoropropan-2-yloxy)hexan-1-ol;sulfuric acid (PubChem CID 88778349) has the molecular formula C9H24FNO6S
and a molecular weight of 293.36 g/mol. Its IUPAC name is azane;6-(2-fluoropropan-2-yloxy)hexan-1-ol;sulfuric acid.
Molecular Properties
| Compound Name | azane;6-(2-fluoropropan-2-yloxy)hexan-1-ol;sulfuric acid |
| PubChem CID | 88778349 |
| Molecular Formula | C9H24FNO6S |
| Molecular Weight | 293.36 g/mol |
| Exact Mass | 293.13 |
| IUPAC Name | azane;6-(2-fluoropropan-2-yloxy)hexan-1-ol;sulfuric acid |
| SMILES | CC(C)(F)OCCCCCCO.N.O=S(=O)(O)O |
| InChI | InChI=1S/C9H19FO2.H3N.H2O4S/c1-9(2,10)12-8-6-4-3-5-7-11;;1-5(2,3)4/h11H,3-8H2,1-2H3;1H3;(H2,1,2,3,4) |
| InChIKey | BQPRANCXEPIOCB-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 139.06 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 293.36 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze azane;6-(2-fluoropropan-2-yloxy)hexan-1-ol;sulfuric acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of azane;6-(2-fluoropropan-2-yloxy)hexan-1-ol;sulfuric acid?
The IUPAC name of azane;6-(2-fluoropropan-2-yloxy)hexan-1-ol;sulfuric acid (CID 88778349) is azane;6-(2-fluoropropan-2-yloxy)hexan-1-ol;sulfuric acid.
What is the SMILES notation for azane;6-(2-fluoropropan-2-yloxy)hexan-1-ol;sulfuric acid?
The canonical SMILES for azane;6-(2-fluoropropan-2-yloxy)hexan-1-ol;sulfuric acid is CC(C)(F)OCCCCCCO.N.O=S(=O)(O)O.
What is the InChIKey of azane;6-(2-fluoropropan-2-yloxy)hexan-1-ol;sulfuric acid?
The InChIKey is BQPRANCXEPIOCB-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H19FO2.H3N.H2O4S/c1-9(2,10)12-8-6-4-3-5-7-11;;1-5(2,3)4/h11H,3-8H2,1-2H3;1H3;(H2,1,2,3,4).
What are the key properties of azane;6-(2-fluoropropan-2-yloxy)hexan-1-ol;sulfuric acid?
azane;6-(2-fluoropropan-2-yloxy)hexan-1-ol;sulfuric acid has a molecular weight of 293.36 g/mol, XLogP of 1.77, 7 rotatable bonds, 4 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for azane;6-(2-fluoropropan-2-yloxy)hexan-1-ol;sulfuric acid is sourced from PubChem (CID 88778349), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).