C21H26N2O4S — CID 88779467
2-hydroxy-3-[3-[2-(2-methylsulfanylphenoxy)ethylamino]propoxy]-2,3-dihydroindole-1-carbaldehyde (PubChem CID 88779467) has the molecular formula C21H26N2O4S and a molecular weight of 402.52 g/mol. Its IUPAC name is 2-hydroxy-3-[3-[2-(2-methylsulfanylphenoxy)ethylamino]propoxy]-2,3-dihydroindole-1-carbaldehyde.
| Compound Name | 2-hydroxy-3-[3-[2-(2-methylsulfanylphenoxy)ethylamino]propoxy]-2,3-dihydroindole-1-carbaldehyde |
|---|---|
| PubChem CID | 88779467 |
| Molecular Formula | C21H26N2O4S |
| Molecular Weight | 402.52 g/mol |
| Exact Mass | 402.16 |
| IUPAC Name | 2-hydroxy-3-[3-[2-(2-methylsulfanylphenoxy)ethylamino]propoxy]-2,3-dihydroindole-1-carbaldehyde |
| SMILES | CSc1ccccc1OCCNCCCOC1c2ccccc2N(C=O)C1O |
| InChI | InChI=1S/C21H26N2O4S/c1-28-19-10-5-4-9-18(19)26-14-12-22-11-6-13-27-20-16-7-2-3-8-17(16)23(15-24)21(20)25/h2-5,7-10,15,20-22,25H,6,11-14H2,1H3 |
| InChIKey | GHSSFBHZASRUEF-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 71.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.52 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|