C21H26N2O4S — CID 88779466
2-hydroxy-3-[1-[2-(2-methyl-3-sulfanylphenoxy)ethylamino]propoxy]-2,3-dihydroindole-1-carbaldehyde (PubChem CID 88779466) has the molecular formula C21H26N2O4S and a molecular weight of 402.52 g/mol. Its IUPAC name is 2-hydroxy-3-[1-[2-(2-methyl-3-sulfanylphenoxy)ethylamino]propoxy]-2,3-dihydroindole-1-carbaldehyde.
| Compound Name | 2-hydroxy-3-[1-[2-(2-methyl-3-sulfanylphenoxy)ethylamino]propoxy]-2,3-dihydroindole-1-carbaldehyde |
|---|---|
| PubChem CID | 88779466 |
| Molecular Formula | C21H26N2O4S |
| Molecular Weight | 402.52 g/mol |
| Exact Mass | 402.16 |
| IUPAC Name | 2-hydroxy-3-[1-[2-(2-methyl-3-sulfanylphenoxy)ethylamino]propoxy]-2,3-dihydroindole-1-carbaldehyde |
| SMILES | CCC(NCCOc1cccc(S)c1C)OC1c2ccccc2N(C=O)C1O |
| InChI | InChI=1S/C21H26N2O4S/c1-3-19(22-11-12-26-17-9-6-10-18(28)14(17)2)27-20-15-7-4-5-8-16(15)23(13-24)21(20)25/h4-10,13,19-22,25,28H,3,11-12H2,1-2H3 |
| InChIKey | RWPASRAKGGEPME-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 71.03 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.52 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|