C23H33IO4 — CID 88779806
[(8S,9S,10S,13S,14S)-17-acetyl-3-hydroxy-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15-dodecahydro-1H-cyclopenta[a]phenanthren-11-yl] 2-iodoacetate (PubChem CID 88779806) has the molecular formula C23H33IO4 and a molecular weight of 500.42 g/mol. Its IUPAC name is [(8S,9S,10S,13S,14S)-17-acetyl-3-hydroxy-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15-dodecahydro-1H-cyclopenta[a]phenanthren-11-yl] 2-iodoacetate.
| Compound Name | [(8S,9S,10S,13S,14S)-17-acetyl-3-hydroxy-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15-dodecahydro-1H-cyclopenta[a]phenanthren-11-yl] 2-iodoacetate |
|---|---|
| PubChem CID | 88779806 |
| Molecular Formula | C23H33IO4 |
| Molecular Weight | 500.42 g/mol |
| Exact Mass | 500.14 |
| IUPAC Name | [(8S,9S,10S,13S,14S)-17-acetyl-3-hydroxy-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15-dodecahydro-1H-cyclopenta[a]phenanthren-11-yl] 2-iodoacetate |
| SMILES | CC(=O)C1=CC[C@H]2[C@@H]3CCC4CC(O)CC[C@]4(C)[C@H]3C(OC(=O)CI)C[C@]12C |
| InChI | InChI=1S/C23H33IO4/c1-13(25)17-6-7-18-16-5-4-14-10-15(26)8-9-22(14,2)21(16)19(11-23(17,18)3)28-20(27)12-24/h6,14-16,18-19,21,26H,4-5,7-12H2,1-3H3/t14?,15?,16-,18-,19?,21+,22-,23+/m0/s1 |
| InChIKey | SRESCFAHSOHKQH-VVIFKBNRSA-N |
| XLogP | 4.47 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.42 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|