C28H40O9S — CID 88780008
[2-[(8S,9S,10R,13S,14S,17R)-11-hydroxy-10,13-dimethyl-17-(2-methylbutoxycarbonyloxy)-3-oxo-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-17-yl]-2-oxoethyl] methanesulfonate (PubChem CID 88780008) has the molecular formula C28H40O9S and a molecular weight of 552.69 g/mol. Its IUPAC name is [2-[(8S,9S,10R,13S,14S,17R)-11-hydroxy-10,13-dimethyl-17-(2-methylbutoxycarbonyloxy)-3-oxo-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-17-yl]-2-oxoethyl] methanesulfonate.
| Compound Name | [2-[(8S,9S,10R,13S,14S,17R)-11-hydroxy-10,13-dimethyl-17-(2-methylbutoxycarbonyloxy)-3-oxo-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-17-yl]-2-oxoethyl] methanesulfonate |
|---|---|
| PubChem CID | 88780008 |
| Molecular Formula | C28H40O9S |
| Molecular Weight | 552.69 g/mol |
| Exact Mass | 552.24 |
| IUPAC Name | [2-[(8S,9S,10R,13S,14S,17R)-11-hydroxy-10,13-dimethyl-17-(2-methylbutoxycarbonyloxy)-3-oxo-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-17-yl]-2-oxoethyl] methanesulfonate |
| SMILES | CCC(C)COC(=O)O[C@]1(C(=O)COS(C)(=O)=O)CC[C@H]2[C@@H]3CCC4=CC(=O)C=C[C@]4(C)[C@H]3C(O)C[C@@]21C |
| InChI | InChI=1S/C28H40O9S/c1-6-17(2)15-35-25(32)37-28(23(31)16-36-38(5,33)34)12-10-21-20-8-7-18-13-19(29)9-11-26(18,3)24(20)22(30)14-27(21,28)4/h9,11,13,17,20-22,24,30H,6-8,10,12,14-16H2,1-5H3/t17?,20-,21-,22?,24+,26-,27-,28-/m0/s1 |
| InChIKey | WYPHAVDALMWIMR-KZRMYKAVSA-N |
| XLogP | 3.75 |
| TPSA | 133.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.69 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|