About 2-(2-aminoethylamino)ethanol;oxalate;silver
2-(2-aminoethylamino)ethanol;oxalate;silver (PubChem CID 88784741) has the molecular formula C6H12AgN2O5-2
and a molecular weight of 300.04 g/mol. Its IUPAC name is 2-(2-aminoethylamino)ethanol;oxalate;silver.
Molecular Properties
| Compound Name | 2-(2-aminoethylamino)ethanol;oxalate;silver |
| PubChem CID | 88784741 |
| Molecular Formula | C6H12AgN2O5-2 |
| Molecular Weight | 300.04 g/mol |
| Exact Mass | 298.98 |
| IUPAC Name | 2-(2-aminoethylamino)ethanol;oxalate;silver |
| SMILES | NCCNCCO.O=C([O-])C(=O)[O-].[Ag] |
| InChI | InChI=1S/C4H12N2O.C2H2O4.Ag/c5-1-2-6-3-4-7;3-1(4)2(5)6;/h6-7H,1-5H2;(H,3,4)(H,5,6);/p-2 |
| InChIKey | ZCQMOYHRMBOEQK-UHFFFAOYSA-L |
| XLogP | -4.99 |
| TPSA | 138.54 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 300.04 |
| LogP ≤ 5 | -4.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|
Analyze 2-(2-aminoethylamino)ethanol;oxalate;silver with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2-aminoethylamino)ethanol;oxalate;silver?
The IUPAC name of 2-(2-aminoethylamino)ethanol;oxalate;silver (CID 88784741) is 2-(2-aminoethylamino)ethanol;oxalate;silver.
What is the SMILES notation for 2-(2-aminoethylamino)ethanol;oxalate;silver?
The canonical SMILES for 2-(2-aminoethylamino)ethanol;oxalate;silver is NCCNCCO.O=C([O-])C(=O)[O-].[Ag].
What is the InChIKey of 2-(2-aminoethylamino)ethanol;oxalate;silver?
The InChIKey is ZCQMOYHRMBOEQK-UHFFFAOYSA-L. The full InChI is InChI=1S/C4H12N2O.C2H2O4.Ag/c5-1-2-6-3-4-7;3-1(4)2(5)6;/h6-7H,1-5H2;(H,3,4)(H,5,6);/p-2.
What are the key properties of 2-(2-aminoethylamino)ethanol;oxalate;silver?
2-(2-aminoethylamino)ethanol;oxalate;silver has a molecular weight of 300.04 g/mol, XLogP of -4.99, 4 rotatable bonds, 3 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2-aminoethylamino)ethanol;oxalate;silver is sourced from PubChem (CID 88784741), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).