C16H15N7O5S3 — CID 88785246
(6S,7R)-7-[(2-hydroxyimino-2-thiophen-2-ylacetyl)amino]-8-oxo-3-[1-(2H-tetrazol-5-ylsulfanyl)ethyl]-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid (PubChem CID 88785246) has the molecular formula C16H15N7O5S3 and a molecular weight of 481.54 g/mol. Its IUPAC name is (6S,7R)-7-[(2-hydroxyimino-2-thiophen-2-ylacetyl)amino]-8-oxo-3-[1-(2H-tetrazol-5-ylsulfanyl)ethyl]-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid.
| Compound Name | (6S,7R)-7-[(2-hydroxyimino-2-thiophen-2-ylacetyl)amino]-8-oxo-3-[1-(2H-tetrazol-5-ylsulfanyl)ethyl]-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid |
|---|---|
| PubChem CID | 88785246 |
| Molecular Formula | C16H15N7O5S3 |
| Molecular Weight | 481.54 g/mol |
| Exact Mass | 481.03 |
| IUPAC Name | (6S,7R)-7-[(2-hydroxyimino-2-thiophen-2-ylacetyl)amino]-8-oxo-3-[1-(2H-tetrazol-5-ylsulfanyl)ethyl]-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid |
| SMILES | CC(Sc1nn[nH]n1)C1=C(C(=O)O)N2C(=O)[C@@H](NC(=O)C(=NO)c3cccs3)[C@@H]2SC1 |
| InChI | InChI=1S/C16H15N7O5S3/c1-6(31-16-18-21-22-19-16)7-5-30-14-10(13(25)23(14)11(7)15(26)27)17-12(24)9(20-28)8-3-2-4-29-8/h2-4,6,10,14,28H,5H2,1H3,(H,17,24)(H,26,27)(H,18,19,21,22)/t6?,10-,14+/m1/s1 |
| InChIKey | XDFHPPYUHURVBL-PSGDUOIOSA-N |
| XLogP | 0.36 |
| TPSA | 173.76 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.54 |
| LogP ≤ 5 | 0.36 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|