C14H31O2PS2 — CID 88785423
hydroxy-[2-methyl-4-(2-methylpropyl)nonan-4-yl]oxy-sulfanyl-sulfanylidene-λ5-phosphane (PubChem CID 88785423) has the molecular formula C14H31O2PS2 and a molecular weight of 326.51 g/mol. Its IUPAC name is hydroxy-[2-methyl-4-(2-methylpropyl)nonan-4-yl]oxy-sulfanyl-sulfanylidene-λ5-phosphane.
| Compound Name | hydroxy-[2-methyl-4-(2-methylpropyl)nonan-4-yl]oxy-sulfanyl-sulfanylidene-λ5-phosphane |
|---|---|
| PubChem CID | 88785423 |
| Molecular Formula | C14H31O2PS2 |
| Molecular Weight | 326.51 g/mol |
| Exact Mass | 326.15 |
| IUPAC Name | hydroxy-[2-methyl-4-(2-methylpropyl)nonan-4-yl]oxy-sulfanyl-sulfanylidene-λ5-phosphane |
| SMILES | CCCCCC(CC(C)C)(CC(C)C)OP(O)(=S)S |
| InChI | InChI=1S/C14H31O2PS2/c1-6-7-8-9-14(10-12(2)3,11-13(4)5)16-17(15,18)19/h12-13H,6-11H2,1-5H3,(H2,15,18,19) |
| InChIKey | JYLTYAPLLFRKKF-UHFFFAOYSA-N |
| XLogP | 5.56 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.51 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|