C21H19F3INO3S2 — CID 88786457
1-(iodomethyl)-4-methylsulfanyl-3-phenyl-5-[3-(trifluoromethyl)phenyl]pyridin-1-ium;methanesulfonate (PubChem CID 88786457) has the molecular formula C21H19F3INO3S2 and a molecular weight of 581.42 g/mol. Its IUPAC name is 1-(iodomethyl)-4-methylsulfanyl-3-phenyl-5-[3-(trifluoromethyl)phenyl]pyridin-1-ium;methanesulfonate.
| Compound Name | 1-(iodomethyl)-4-methylsulfanyl-3-phenyl-5-[3-(trifluoromethyl)phenyl]pyridin-1-ium;methanesulfonate |
|---|---|
| PubChem CID | 88786457 |
| Molecular Formula | C21H19F3INO3S2 |
| Molecular Weight | 581.42 g/mol |
| Exact Mass | 580.98 |
| IUPAC Name | 1-(iodomethyl)-4-methylsulfanyl-3-phenyl-5-[3-(trifluoromethyl)phenyl]pyridin-1-ium;methanesulfonate |
| SMILES | CS(=O)(=O)[O-].CSc1c(-c2ccccc2)c[n+](CI)cc1-c1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C20H16F3INS.CH4O3S/c1-26-19-17(14-6-3-2-4-7-14)11-25(13-24)12-18(19)15-8-5-9-16(10-15)20(21,22)23;1-5(2,3)4/h2-12H,13H2,1H3;1H3,(H,2,3,4)/q+1;/p-1 |
| InChIKey | AVITWYXTADDHDW-UHFFFAOYSA-M |
| XLogP | 5.60 |
| TPSA | 61.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 581.42 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|