C13H17N3S2 — CID 88790894
1-(5-phenyl-4-propyl-1,2,4-triazol-3-yl)ethane-1,2-dithiol (PubChem CID 88790894) has the molecular formula C13H17N3S2 and a molecular weight of 279.43 g/mol. Its IUPAC name is 1-(5-phenyl-4-propyl-1,2,4-triazol-3-yl)ethane-1,2-dithiol.
| Compound Name | 1-(5-phenyl-4-propyl-1,2,4-triazol-3-yl)ethane-1,2-dithiol |
|---|---|
| PubChem CID | 88790894 |
| Molecular Formula | C13H17N3S2 |
| Molecular Weight | 279.43 g/mol |
| Exact Mass | 279.09 |
| IUPAC Name | 1-(5-phenyl-4-propyl-1,2,4-triazol-3-yl)ethane-1,2-dithiol |
| SMILES | CCCn1c(-c2ccccc2)nnc1C(S)CS |
| InChI | InChI=1S/C13H17N3S2/c1-2-8-16-12(10-6-4-3-5-7-10)14-15-13(16)11(18)9-17/h3-7,11,17-18H,2,8-9H2,1H3 |
| InChIKey | OSZPANWUSJDBJN-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 30.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.43 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|