C25H36N2O3 — CID 88791171
benzene;1,1-dimethyl-3-[4-(prop-2-ynoxymethoxy)phenyl]urea;hexane (PubChem CID 88791171) has the molecular formula C25H36N2O3 and a molecular weight of 412.57 g/mol. Its IUPAC name is benzene;1,1-dimethyl-3-[4-(prop-2-ynoxymethoxy)phenyl]urea;hexane.
| Compound Name | benzene;1,1-dimethyl-3-[4-(prop-2-ynoxymethoxy)phenyl]urea;hexane |
|---|---|
| PubChem CID | 88791171 |
| Molecular Formula | C25H36N2O3 |
| Molecular Weight | 412.57 g/mol |
| Exact Mass | 412.27 |
| IUPAC Name | benzene;1,1-dimethyl-3-[4-(prop-2-ynoxymethoxy)phenyl]urea;hexane |
| SMILES | C#CCOCOc1ccc(NC(=O)N(C)C)cc1.CCCCCC.c1ccccc1 |
| InChI | InChI=1S/C13H16N2O3.C6H6.C6H14/c1-4-9-17-10-18-12-7-5-11(6-8-12)14-13(16)15(2)3;1-2-4-6-5-3-1;1-3-5-6-4-2/h1,5-8H,9-10H2,2-3H3,(H,14,16);1-6H;3-6H2,1-2H3 |
| InChIKey | LIZYBVKDIFNEKI-UHFFFAOYSA-N |
| XLogP | 6.04 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.57 |
| LogP ≤ 5 | 6.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|