C14H17N3O4 — CID 88834767
[3-(dimethylcarbamoylamino)phenyl]-(prop-2-ynoxymethyl)carbamic acid (PubChem CID 88834767) has the molecular formula C14H17N3O4 and a molecular weight of 291.31 g/mol. Its IUPAC name is [3-(dimethylcarbamoylamino)phenyl]-(prop-2-ynoxymethyl)carbamic acid.
| Compound Name | [3-(dimethylcarbamoylamino)phenyl]-(prop-2-ynoxymethyl)carbamic acid |
|---|---|
| PubChem CID | 88834767 |
| Molecular Formula | C14H17N3O4 |
| Molecular Weight | 291.31 g/mol |
| Exact Mass | 291.12 |
| IUPAC Name | [3-(dimethylcarbamoylamino)phenyl]-(prop-2-ynoxymethyl)carbamic acid |
| SMILES | C#CCOCN(C(=O)O)c1cccc(NC(=O)N(C)C)c1 |
| InChI | InChI=1S/C14H17N3O4/c1-4-8-21-10-17(14(19)20)12-7-5-6-11(9-12)15-13(18)16(2)3/h1,5-7,9H,8,10H2,2-3H3,(H,15,18)(H,19,20) |
| InChIKey | ZJOYUGANMWNMRD-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 82.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.31 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|