C12H13N3O3 — CID 126549731
1,1-dimethyl-3-(3-nitroso-4-prop-2-ynoxyphenyl)urea (PubChem CID 126549731) has the molecular formula C12H13N3O3 and a molecular weight of 247.25 g/mol. Its IUPAC name is 1,1-dimethyl-3-(3-nitroso-4-prop-2-ynoxyphenyl)urea.
| Compound Name | 1,1-dimethyl-3-(3-nitroso-4-prop-2-ynoxyphenyl)urea |
|---|---|
| PubChem CID | 126549731 |
| Molecular Formula | C12H13N3O3 |
| Molecular Weight | 247.25 g/mol |
| Exact Mass | 247.10 |
| IUPAC Name | 1,1-dimethyl-3-(3-nitroso-4-prop-2-ynoxyphenyl)urea |
| SMILES | C#CCOc1ccc(NC(=O)N(C)C)cc1N=O |
| InChI | InChI=1S/C12H13N3O3/c1-4-7-18-11-6-5-9(8-10(11)14-17)13-12(16)15(2)3/h1,5-6,8H,7H2,2-3H3,(H,13,16) |
| InChIKey | UFKLJQBIUYTPRC-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 71.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.25 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|