C11H11ClN2O2 — CID 118123567
1-(4-chloro-3-prop-2-ynoxyphenyl)-3-methylurea (PubChem CID 118123567) has the molecular formula C11H11ClN2O2 and a molecular weight of 238.67 g/mol. Its IUPAC name is 1-(4-chloro-3-prop-2-ynoxyphenyl)-3-methylurea.
| Compound Name | 1-(4-chloro-3-prop-2-ynoxyphenyl)-3-methylurea |
|---|---|
| PubChem CID | 118123567 |
| Molecular Formula | C11H11ClN2O2 |
| Molecular Weight | 238.67 g/mol |
| Exact Mass | 238.05 |
| IUPAC Name | 1-(4-chloro-3-prop-2-ynoxyphenyl)-3-methylurea |
| SMILES | C#CCOc1cc(NC(=O)NC)ccc1Cl |
| InChI | InChI=1S/C11H11ClN2O2/c1-3-6-16-10-7-8(4-5-9(10)12)14-11(15)13-2/h1,4-5,7H,6H2,2H3,(H2,13,14,15) |
| InChIKey | GAISLXVMRPJRQY-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.67 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|