C23H18ClN3O4 — CID 144854054
1-[4-chloro-3-[6-[4-[(Z)-1-cyano-2-hydroxyethenyl]phenoxy]hexa-2,4-diynoxy]phenyl]-3-methylurea (PubChem CID 144854054) has the molecular formula C23H18ClN3O4 and a molecular weight of 435.87 g/mol. Its IUPAC name is 1-[4-chloro-3-[6-[4-[(Z)-1-cyano-2-hydroxyethenyl]phenoxy]hexa-2,4-diynoxy]phenyl]-3-methylurea.
| Compound Name | 1-[4-chloro-3-[6-[4-[(Z)-1-cyano-2-hydroxyethenyl]phenoxy]hexa-2,4-diynoxy]phenyl]-3-methylurea |
|---|---|
| PubChem CID | 144854054 |
| Molecular Formula | C23H18ClN3O4 |
| Molecular Weight | 435.87 g/mol |
| Exact Mass | 435.10 |
| IUPAC Name | 1-[4-chloro-3-[6-[4-[(Z)-1-cyano-2-hydroxyethenyl]phenoxy]hexa-2,4-diynoxy]phenyl]-3-methylurea |
| SMILES | CNC(=O)Nc1ccc(Cl)c(OCC#CC#CCOc2ccc(/C(C#N)=C/O)cc2)c1 |
| InChI | InChI=1S/C23H18ClN3O4/c1-26-23(29)27-19-8-11-21(24)22(14-19)31-13-5-3-2-4-12-30-20-9-6-17(7-10-20)18(15-25)16-28/h6-11,14,16,28H,12-13H2,1H3,(H2,26,27,29)/b18-16+ |
| InChIKey | UXPBVDSSAYXMOY-FBMGVBCBSA-N |
| XLogP | 3.98 |
| TPSA | 103.61 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.87 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|