C15H12ClNO2S — CID 3000931
N-(4-chloro-3-prop-2-ynoxyphenyl)-2-methylfuran-3-carbothioamide (PubChem CID 3000931) has the molecular formula C15H12ClNO2S and a molecular weight of 305.79 g/mol. Its IUPAC name is N-(4-chloro-3-prop-2-ynoxyphenyl)-2-methylfuran-3-carbothioamide.
| Compound Name | N-(4-chloro-3-prop-2-ynoxyphenyl)-2-methylfuran-3-carbothioamide |
|---|---|
| PubChem CID | 3000931 |
| Molecular Formula | C15H12ClNO2S |
| Molecular Weight | 305.79 g/mol |
| Exact Mass | 305.03 |
| IUPAC Name | N-(4-chloro-3-prop-2-ynoxyphenyl)-2-methylfuran-3-carbothioamide |
| SMILES | C#CCOc1cc(NC(=S)c2ccoc2C)ccc1Cl |
| InChI | InChI=1S/C15H12ClNO2S/c1-3-7-19-14-9-11(4-5-13(14)16)17-15(20)12-6-8-18-10(12)2/h1,4-6,8-9H,7H2,2H3,(H,17,20) |
| InChIKey | CMIBSTODLGTJJH-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 34.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.79 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|