C15H12Cl3NOS2 — CID 3002229
N-[4-chloro-3-(3,3-dichloroprop-2-enylsulfanyl)phenyl]-2-methylfuran-3-carbothioamide (PubChem CID 3002229) has the molecular formula C15H12Cl3NOS2 and a molecular weight of 392.76 g/mol. Its IUPAC name is N-[4-chloro-3-(3,3-dichloroprop-2-enylsulfanyl)phenyl]-2-methylfuran-3-carbothioamide.
| Compound Name | N-[4-chloro-3-(3,3-dichloroprop-2-enylsulfanyl)phenyl]-2-methylfuran-3-carbothioamide |
|---|---|
| PubChem CID | 3002229 |
| Molecular Formula | C15H12Cl3NOS2 |
| Molecular Weight | 392.76 g/mol |
| Exact Mass | 390.94 |
| IUPAC Name | N-[4-chloro-3-(3,3-dichloroprop-2-enylsulfanyl)phenyl]-2-methylfuran-3-carbothioamide |
| SMILES | Cc1occc1C(=S)Nc1ccc(Cl)c(SCC=C(Cl)Cl)c1 |
| InChI | InChI=1S/C15H12Cl3NOS2/c1-9-11(4-6-20-9)15(21)19-10-2-3-12(16)13(8-10)22-7-5-14(17)18/h2-6,8H,7H2,1H3,(H,19,21) |
| InChIKey | MZIWVZFAQDXZGG-UHFFFAOYSA-N |
| XLogP | 6.44 |
| TPSA | 25.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.76 |
| LogP ≤ 5 | 6.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|