C17H18ClNO3S — CID 3000992
propan-2-yl 2-chloro-5-[(2,4-dimethylfuran-3-carbothioyl)amino]benzoate (PubChem CID 3000992) has the molecular formula C17H18ClNO3S and a molecular weight of 351.86 g/mol. Its IUPAC name is propan-2-yl 2-chloro-5-[(2,4-dimethylfuran-3-carbothioyl)amino]benzoate.
| Compound Name | propan-2-yl 2-chloro-5-[(2,4-dimethylfuran-3-carbothioyl)amino]benzoate |
|---|---|
| PubChem CID | 3000992 |
| Molecular Formula | C17H18ClNO3S |
| Molecular Weight | 351.86 g/mol |
| Exact Mass | 351.07 |
| IUPAC Name | propan-2-yl 2-chloro-5-[(2,4-dimethylfuran-3-carbothioyl)amino]benzoate |
| SMILES | Cc1coc(C)c1C(=S)Nc1ccc(Cl)c(C(=O)OC(C)C)c1 |
| InChI | InChI=1S/C17H18ClNO3S/c1-9(2)22-17(20)13-7-12(5-6-14(13)18)19-16(23)15-10(3)8-21-11(15)4/h5-9H,1-4H3,(H,19,23) |
| InChIKey | SLLNTNIYGWSEOC-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 51.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.86 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|