C15H21NO3S2 — CID 3001527
propan-2-yl 2-methylsulfanyl-5-(propan-2-yloxycarbothioylamino)benzoate (PubChem CID 3001527) has the molecular formula C15H21NO3S2 and a molecular weight of 327.47 g/mol. Its IUPAC name is propan-2-yl 2-methylsulfanyl-5-(propan-2-yloxycarbothioylamino)benzoate.
| Compound Name | propan-2-yl 2-methylsulfanyl-5-(propan-2-yloxycarbothioylamino)benzoate |
|---|---|
| PubChem CID | 3001527 |
| Molecular Formula | C15H21NO3S2 |
| Molecular Weight | 327.47 g/mol |
| Exact Mass | 327.10 |
| IUPAC Name | propan-2-yl 2-methylsulfanyl-5-(propan-2-yloxycarbothioylamino)benzoate |
| SMILES | CSc1ccc(NC(=S)OC(C)C)cc1C(=O)OC(C)C |
| InChI | InChI=1S/C15H21NO3S2/c1-9(2)18-14(17)12-8-11(6-7-13(12)21-5)16-15(20)19-10(3)4/h6-10H,1-5H3,(H,16,20) |
| InChIKey | IGMYCPPAEIIVDP-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.47 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|