C16H24ClNO3SSi — CID 3001535
2-trimethylsilylethyl 2-chloro-5-(propan-2-yloxycarbothioylamino)benzoate (PubChem CID 3001535) has the molecular formula C16H24ClNO3SSi and a molecular weight of 373.98 g/mol. Its IUPAC name is 2-trimethylsilylethyl 2-chloro-5-(propan-2-yloxycarbothioylamino)benzoate.
| Compound Name | 2-trimethylsilylethyl 2-chloro-5-(propan-2-yloxycarbothioylamino)benzoate |
|---|---|
| PubChem CID | 3001535 |
| Molecular Formula | C16H24ClNO3SSi |
| Molecular Weight | 373.98 g/mol |
| Exact Mass | 373.09 |
| IUPAC Name | 2-trimethylsilylethyl 2-chloro-5-(propan-2-yloxycarbothioylamino)benzoate |
| SMILES | CC(C)OC(=S)Nc1ccc(Cl)c(C(=O)OCC[Si](C)(C)C)c1 |
| InChI | InChI=1S/C16H24ClNO3SSi/c1-11(2)21-16(22)18-12-6-7-14(17)13(10-12)15(19)20-8-9-23(3,4)5/h6-7,10-11H,8-9H2,1-5H3,(H,18,22) |
| InChIKey | QTSAVFNFUSSLKN-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.98 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|