C17H22ClNO3S — CID 3005976
propan-2-yl 2-chloro-5-(cyclohexyloxycarbothioylamino)benzoate (PubChem CID 3005976) has the molecular formula C17H22ClNO3S and a molecular weight of 355.89 g/mol. Its IUPAC name is propan-2-yl 2-chloro-5-(cyclohexyloxycarbothioylamino)benzoate.
| Compound Name | propan-2-yl 2-chloro-5-(cyclohexyloxycarbothioylamino)benzoate |
|---|---|
| PubChem CID | 3005976 |
| Molecular Formula | C17H22ClNO3S |
| Molecular Weight | 355.89 g/mol |
| Exact Mass | 355.10 |
| IUPAC Name | propan-2-yl 2-chloro-5-(cyclohexyloxycarbothioylamino)benzoate |
| SMILES | CC(C)OC(=O)c1cc(NC(=S)OC2CCCCC2)ccc1Cl |
| InChI | InChI=1S/C17H22ClNO3S/c1-11(2)21-16(20)14-10-12(8-9-15(14)18)19-17(23)22-13-6-4-3-5-7-13/h8-11,13H,3-7H2,1-2H3,(H,19,23) |
| InChIKey | JYBDZPDOJIUOPT-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.89 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|