C19H20ClNO2S2 — CID 3000955
cyclohexyl 2-chloro-5-[(3-methylthiophene-2-carbothioyl)amino]benzoate (PubChem CID 3000955) has the molecular formula C19H20ClNO2S2 and a molecular weight of 393.96 g/mol. Its IUPAC name is cyclohexyl 2-chloro-5-[(3-methylthiophene-2-carbothioyl)amino]benzoate.
| Compound Name | cyclohexyl 2-chloro-5-[(3-methylthiophene-2-carbothioyl)amino]benzoate |
|---|---|
| PubChem CID | 3000955 |
| Molecular Formula | C19H20ClNO2S2 |
| Molecular Weight | 393.96 g/mol |
| Exact Mass | 393.06 |
| IUPAC Name | cyclohexyl 2-chloro-5-[(3-methylthiophene-2-carbothioyl)amino]benzoate |
| SMILES | Cc1ccsc1C(=S)Nc1ccc(Cl)c(C(=O)OC2CCCCC2)c1 |
| InChI | InChI=1S/C19H20ClNO2S2/c1-12-9-10-25-17(12)18(24)21-13-7-8-16(20)15(11-13)19(22)23-14-5-3-2-4-6-14/h7-11,14H,2-6H2,1H3,(H,21,24) |
| InChIKey | BIJMVSYUOVPQQK-UHFFFAOYSA-N |
| XLogP | 5.99 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.96 |
| LogP ≤ 5 | 5.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|