C19H25ClFN3O5 — CID 70510257
propan-2-yl 2-chloro-5-[(cycloheptyloxycarbonylamino)carbamoylamino]-4-fluorobenzoate (PubChem CID 70510257) has the molecular formula C19H25ClFN3O5 and a molecular weight of 429.88 g/mol. Its IUPAC name is propan-2-yl 2-chloro-5-[(cycloheptyloxycarbonylamino)carbamoylamino]-4-fluorobenzoate.
| Compound Name | propan-2-yl 2-chloro-5-[(cycloheptyloxycarbonylamino)carbamoylamino]-4-fluorobenzoate |
|---|---|
| PubChem CID | 70510257 |
| Molecular Formula | C19H25ClFN3O5 |
| Molecular Weight | 429.88 g/mol |
| Exact Mass | 429.15 |
| IUPAC Name | propan-2-yl 2-chloro-5-[(cycloheptyloxycarbonylamino)carbamoylamino]-4-fluorobenzoate |
| SMILES | CC(C)OC(=O)c1cc(NC(=O)NNC(=O)OC2CCCCCC2)c(F)cc1Cl |
| InChI | InChI=1S/C19H25ClFN3O5/c1-11(2)28-17(25)13-9-16(15(21)10-14(13)20)22-18(26)23-24-19(27)29-12-7-5-3-4-6-8-12/h9-12H,3-8H2,1-2H3,(H,24,27)(H2,22,23,26) |
| InChIKey | NASAMIUVMLRCJT-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 105.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.88 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|