C17H21ClN2O4S — CID 57044523
propan-2-yl 2-chloro-5-[(4-ethoxy-4-oxobutan-2-ylidene)carbamothioylamino]benzoate (PubChem CID 57044523) has the molecular formula C17H21ClN2O4S and a molecular weight of 384.89 g/mol. Its IUPAC name is propan-2-yl 2-chloro-5-[(4-ethoxy-4-oxobutan-2-ylidene)carbamothioylamino]benzoate.
| Compound Name | propan-2-yl 2-chloro-5-[(4-ethoxy-4-oxobutan-2-ylidene)carbamothioylamino]benzoate |
|---|---|
| PubChem CID | 57044523 |
| Molecular Formula | C17H21ClN2O4S |
| Molecular Weight | 384.89 g/mol |
| Exact Mass | 384.09 |
| IUPAC Name | propan-2-yl 2-chloro-5-[(4-ethoxy-4-oxobutan-2-ylidene)carbamothioylamino]benzoate |
| SMILES | CCOC(=O)CC(C)=NC(=S)Nc1ccc(Cl)c(C(=O)OC(C)C)c1 |
| InChI | InChI=1S/C17H21ClN2O4S/c1-5-23-15(21)8-11(4)19-17(25)20-12-6-7-14(18)13(9-12)16(22)24-10(2)3/h6-7,9-10H,5,8H2,1-4H3,(H,20,25) |
| InChIKey | VBQQFLNKTYNEST-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 76.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.89 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|