C17H20ClNOS2 — CID 3000896
N-[4-chloro-3-(2,2-dimethylpropoxy)phenyl]-2-methylthiophene-3-carbothioamide (PubChem CID 3000896) has the molecular formula C17H20ClNOS2 and a molecular weight of 353.94 g/mol. Its IUPAC name is N-[4-chloro-3-(2,2-dimethylpropoxy)phenyl]-2-methylthiophene-3-carbothioamide.
| Compound Name | N-[4-chloro-3-(2,2-dimethylpropoxy)phenyl]-2-methylthiophene-3-carbothioamide |
|---|---|
| PubChem CID | 3000896 |
| Molecular Formula | C17H20ClNOS2 |
| Molecular Weight | 353.94 g/mol |
| Exact Mass | 353.07 |
| IUPAC Name | N-[4-chloro-3-(2,2-dimethylpropoxy)phenyl]-2-methylthiophene-3-carbothioamide |
| SMILES | Cc1sccc1C(=S)Nc1ccc(Cl)c(OCC(C)(C)C)c1 |
| InChI | InChI=1S/C17H20ClNOS2/c1-11-13(7-8-22-11)16(21)19-12-5-6-14(18)15(9-12)20-10-17(2,3)4/h5-9H,10H2,1-4H3,(H,19,21) |
| InChIKey | VMOHENJEUMJNLD-UHFFFAOYSA-N |
| XLogP | 5.92 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.94 |
| LogP ≤ 5 | 5.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|