C5H11F2NO — CID 88791900
N,N-difluoro-2-propoxyethanamine (PubChem CID 88791900) has the molecular formula C5H11F2NO and a molecular weight of 139.15 g/mol. Its IUPAC name is N,N-difluoro-2-propoxyethanamine.
| Compound Name | N,N-difluoro-2-propoxyethanamine |
|---|---|
| PubChem CID | 88791900 |
| Molecular Formula | C5H11F2NO |
| Molecular Weight | 139.15 g/mol |
| Exact Mass | 139.08 |
| IUPAC Name | N,N-difluoro-2-propoxyethanamine |
| SMILES | CCCOCCN(F)F |
| InChI | InChI=1S/C5H11F2NO/c1-2-4-9-5-3-8(6)7/h2-5H2,1H3 |
| InChIKey | SWFKKYIDPWEMCT-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 139.15 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|